About [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride
[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride (PubChem CID 87493797) has the molecular formula C14H18Cl2OTi
and a molecular weight of 321.07 g/mol. Its IUPAC name is [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride.
Molecular Properties
| Compound Name | [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride |
| PubChem CID | 87493797 |
| Molecular Formula | C14H18Cl2OTi |
| Molecular Weight | 321.07 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride |
| SMILES | CC1=CC(C)=C(c2ccccc2CO)C1.Cl.Cl.[Ti] |
| InChI | InChI=1S/C14H16O.2ClH.Ti/c1-10-7-11(2)14(8-10)13-6-4-3-5-12(13)9-15;;;/h3-7,15H,8-9H2,1-2H3;2*1H; |
| InChIKey | PSKXXFKGGBUYPN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.07 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride?
The IUPAC name of [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride (CID 87493797) is [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride.
What is the SMILES notation for [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride?
The canonical SMILES for [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride is CC1=CC(C)=C(c2ccccc2CO)C1.Cl.Cl.[Ti].
What is the InChIKey of [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride?
The InChIKey is PSKXXFKGGBUYPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O.2ClH.Ti/c1-10-7-11(2)14(8-10)13-6-4-3-5-12(13)9-15;;;/h3-7,15H,8-9H2,1-2H3;2*1H;.
What are the key properties of [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride?
[2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride has a molecular weight of 321.07 g/mol, XLogP of 4.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethylcyclopenta-1,3-dien-1-yl)phenyl]methanol;titanium;dihydrochloride is sourced from PubChem (CID 87493797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).