C17H17NO3 — CID 874944
1-[3-[(2,5-dimethoxyphenyl)methylideneamino]phenyl]ethanone (PubChem CID 874944) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[3-[(2,5-dimethoxyphenyl)methylideneamino]phenyl]ethanone.
| Compound Name | 1-[3-[(2,5-dimethoxyphenyl)methylideneamino]phenyl]ethanone |
|---|---|
| PubChem CID | 874944 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-[3-[(2,5-dimethoxyphenyl)methylideneamino]phenyl]ethanone |
| SMILES | COc1ccc(OC)c(/C=N/c2cccc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C17H17NO3/c1-12(19)13-5-4-6-15(9-13)18-11-14-10-16(20-2)7-8-17(14)21-3/h4-11H,1-3H3/b18-11+ |
| InChIKey | HAVVXPOMAMFFTE-WOJGMQOQSA-N |
| XLogP | 3.66 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|