About 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine
2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine (PubChem CID 87494443) has the molecular formula C12H30N4
and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine |
| PubChem CID | 87494443 |
| Molecular Formula | C12H30N4 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.25 |
| IUPAC Name | 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine |
| SMILES | CC(C)(CN)N(C(C)(C)CN)C(C)(C)CN |
| InChI | InChI=1S/C12H30N4/c1-10(2,7-13)16(11(3,4)8-14)12(5,6)9-15/h7-9,13-15H2,1-6H3 |
| InChIKey | BYWHZRPAQNAXJA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine?
The IUPAC name of 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine (CID 87494443) is 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine.
What is the SMILES notation for 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine?
The canonical SMILES for 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine is CC(C)(CN)N(C(C)(C)CN)C(C)(C)CN.
What is the InChIKey of 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine?
The InChIKey is BYWHZRPAQNAXJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H30N4/c1-10(2,7-13)16(11(3,4)8-14)12(5,6)9-15/h7-9,13-15H2,1-6H3.
What are the key properties of 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine?
2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine has a molecular weight of 230.40 g/mol, XLogP of 0.50, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,2-N-bis(1-amino-2-methylpropan-2-yl)-2-methylpropane-1,2-diamine is sourced from PubChem (CID 87494443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).