C10H12F8 — CID 87494958
1-ethyl-2,2,3,3,4,4,5,5-octafluoro-1-propylcyclopentane (PubChem CID 87494958) has the molecular formula C10H12F8 and a molecular weight of 284.19 g/mol. Its IUPAC name is 1-ethyl-2,2,3,3,4,4,5,5-octafluoro-1-propylcyclopentane.
| Compound Name | 1-ethyl-2,2,3,3,4,4,5,5-octafluoro-1-propylcyclopentane |
|---|---|
| PubChem CID | 87494958 |
| Molecular Formula | C10H12F8 |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-ethyl-2,2,3,3,4,4,5,5-octafluoro-1-propylcyclopentane |
| SMILES | CCCC1(CC)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H12F8/c1-3-5-6(4-2)7(11,12)9(15,16)10(17,18)8(6,13)14/h3-5H2,1-2H3 |
| InChIKey | CPPJROFGRFBRGW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|