C25H44OSi — CID 87495316
[(1S,3aS,4R,7aS)-7a-methyl-1-[(2E,4E,7E)-nona-2,4,7-trien-5-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 87495316) has the molecular formula C25H44OSi and a molecular weight of 388.71 g/mol. Its IUPAC name is [(1S,3aS,4R,7aS)-7a-methyl-1-[(2E,4E,7E)-nona-2,4,7-trien-5-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,3aS,4R,7aS)-7a-methyl-1-[(2E,4E,7E)-nona-2,4,7-trien-5-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 87495316 |
| Molecular Formula | C25H44OSi |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 388.32 |
| IUPAC Name | [(1S,3aS,4R,7aS)-7a-methyl-1-[(2E,4E,7E)-nona-2,4,7-trien-5-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C=C/C=C(\C/C=C/C)[C@@H]1CC[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@]21C |
| InChI | InChI=1S/C25H44OSi/c1-9-11-14-20(15-12-10-2)21-17-18-22-23(16-13-19-25(21,22)6)26-27(7,8)24(3,4)5/h9-12,14,21-23H,13,15-19H2,1-8H3/b11-9+,12-10+,20-14+/t21-,22+,23+,25-/m0/s1 |
| InChIKey | YDZKASDXCYJKHS-KWEUCRNESA-N |
| XLogP | 8.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|