About 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol
3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol (PubChem CID 87495336) has the molecular formula C19H20O4S2
and a molecular weight of 376.50 g/mol. Its IUPAC name is 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol.
Molecular Properties
| Compound Name | 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol |
| PubChem CID | 87495336 |
| Molecular Formula | C19H20O4S2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)c(SCCc2ccco2)c1SCCc1ccco1 |
| InChI | InChI=1S/C19H20O4S2/c1-13-12-16(20)17(21)19(25-11-7-15-5-3-9-23-15)18(13)24-10-6-14-4-2-8-22-14/h2-5,8-9,12,20-21H,6-7,10-11H2,1H3 |
| InChIKey | JOBOXHVAFYRQJJ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol?
The IUPAC name of 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol (CID 87495336) is 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol.
What is the SMILES notation for 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol?
The canonical SMILES for 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol is Cc1cc(O)c(O)c(SCCc2ccco2)c1SCCc1ccco1.
What is the InChIKey of 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol?
The InChIKey is JOBOXHVAFYRQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O4S2/c1-13-12-16(20)17(21)19(25-11-7-15-5-3-9-23-15)18(13)24-10-6-14-4-2-8-22-14/h2-5,8-9,12,20-21H,6-7,10-11H2,1H3.
What are the key properties of 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol?
3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol has a molecular weight of 376.50 g/mol, XLogP of 5.26, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis[2-(furan-2-yl)ethylsulfanyl]-5-methylbenzene-1,2-diol is sourced from PubChem (CID 87495336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).