C14H21NO6S — CID 87495462
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;pyrrolidine-2,5-dione (PubChem CID 87495462) has the molecular formula C14H21NO6S and a molecular weight of 331.39 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;pyrrolidine-2,5-dione.
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 87495462 |
| Molecular Formula | C14H21NO6S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;pyrrolidine-2,5-dione |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.O=C1CCC(=O)N1 |
| InChI | InChI=1S/C10H16O4S.C4H5NO2/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;6-3-1-2-4(7)5-3/h7H,3-6H2,1-2H3,(H,12,13,14);1-2H2,(H,5,6,7) |
| InChIKey | XABNSCWKCDPLEX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 117.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|