C11H15ClN4O2 — CID 87495589
3-chloro-4-morpholin-4-yl-4,5,6,7-tetrahydropyrido[3,4-d]pyrimidin-8-one (PubChem CID 87495589) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-chloro-4-morpholin-4-yl-4,5,6,7-tetrahydropyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 3-chloro-4-morpholin-4-yl-4,5,6,7-tetrahydropyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 87495589 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 3-chloro-4-morpholin-4-yl-4,5,6,7-tetrahydropyrido[3,4-d]pyrimidin-8-one |
| SMILES | O=C1NCCC2=C1N=CN(Cl)C2N1CCOCC1 |
| InChI | InChI=1S/C11H15ClN4O2/c12-16-7-14-9-8(1-2-13-10(9)17)11(16)15-3-5-18-6-4-15/h7,11H,1-6H2,(H,13,17) |
| InChIKey | NHEOKICEPHPAOD-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|