About acetonitrile;2-cyanoethoxyphosphonamidous acid
acetonitrile;2-cyanoethoxyphosphonamidous acid (PubChem CID 87496735) has the molecular formula C5H10N3O2P
and a molecular weight of 175.13 g/mol. Its IUPAC name is acetonitrile;2-cyanoethoxyphosphonamidous acid.
Molecular Properties
| Compound Name | acetonitrile;2-cyanoethoxyphosphonamidous acid |
| PubChem CID | 87496735 |
| Molecular Formula | C5H10N3O2P |
| Molecular Weight | 175.13 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | acetonitrile;2-cyanoethoxyphosphonamidous acid |
| SMILES | CC#N.N#CCCOP(N)O |
| InChI | InChI=1S/C3H7N2O2P.C2H3N/c4-2-1-3-7-8(5)6;1-2-3/h6H,1,3,5H2;1H3 |
| InChIKey | MFWNCPVWQGWMET-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.13 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;2-cyanoethoxyphosphonamidous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-cyanoethoxyphosphonamidous acid?
The IUPAC name of acetonitrile;2-cyanoethoxyphosphonamidous acid (CID 87496735) is acetonitrile;2-cyanoethoxyphosphonamidous acid.
What is the SMILES notation for acetonitrile;2-cyanoethoxyphosphonamidous acid?
The canonical SMILES for acetonitrile;2-cyanoethoxyphosphonamidous acid is CC#N.N#CCCOP(N)O.
What is the InChIKey of acetonitrile;2-cyanoethoxyphosphonamidous acid?
The InChIKey is MFWNCPVWQGWMET-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N2O2P.C2H3N/c4-2-1-3-7-8(5)6;1-2-3/h6H,1,3,5H2;1H3.
What are the key properties of acetonitrile;2-cyanoethoxyphosphonamidous acid?
acetonitrile;2-cyanoethoxyphosphonamidous acid has a molecular weight of 175.13 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-cyanoethoxyphosphonamidous acid is sourced from PubChem (CID 87496735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).