C10H18ClN4O3+ — CID 87496890
4-(1-chloro-4,6-dimethoxy-2H-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium (PubChem CID 87496890) has the molecular formula C10H18ClN4O3+ and a molecular weight of 277.73 g/mol. Its IUPAC name is 4-(1-chloro-4,6-dimethoxy-2H-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium.
| Compound Name | 4-(1-chloro-4,6-dimethoxy-2H-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium |
|---|---|
| PubChem CID | 87496890 |
| Molecular Formula | C10H18ClN4O3+ |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-(1-chloro-4,6-dimethoxy-2H-1,3,5-triazin-2-yl)-4-methylmorpholin-4-ium |
| SMILES | COC1=NC([N+]2(C)CCOCC2)N(Cl)C(OC)=N1 |
| InChI | InChI=1S/C10H18ClN4O3/c1-15(4-6-18-7-5-15)9-12-8(16-2)13-10(17-3)14(9)11/h9H,4-7H2,1-3H3/q+1 |
| InChIKey | YPSMMITVFNYWHG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 55.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|