About 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane
2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane (PubChem CID 87497105) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane.
Molecular Properties
| Compound Name | 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane |
| PubChem CID | 87497105 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane |
| SMILES | CC(C)(C)OC(C)(C)C.CC1CO1 |
| InChI | InChI=1S/C8H18O.C3H6O/c1-7(2,3)9-8(4,5)6;1-3-2-4-3/h1-6H3;3H,2H2,1H3 |
| InChIKey | NWKLEHXJZSSBHF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane?
The IUPAC name of 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane (CID 87497105) is 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane.
What is the SMILES notation for 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane?
The canonical SMILES for 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane is CC(C)(C)OC(C)(C)C.CC1CO1.
What is the InChIKey of 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane?
The InChIKey is NWKLEHXJZSSBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.C3H6O/c1-7(2,3)9-8(4,5)6;1-3-2-4-3/h1-6H3;3H,2H2,1H3.
What are the key properties of 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane?
2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane has a molecular weight of 188.31 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(2-methylpropan-2-yl)oxy]propane;2-methyloxirane is sourced from PubChem (CID 87497105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).