About [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate
[(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 87497191) has the molecular formula C10H14N4O5
and a molecular weight of 270.25 g/mol. Its IUPAC name is [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| PubChem CID | 87497191 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | NCCC[C@@H](N)C(=O)OC(=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H14N4O5/c11-3-1-2-5(12)8(16)19-9(17)6-4-7(15)14-10(18)13-6/h4-5H,1-3,11-12H2,(H2,13,14,15,18)/t5-/m1/s1 |
| InChIKey | DCLSOJDVBSHQFL-RXMQYKEDSA-N |
| XLogP | -2.19 |
| TPSA | 161.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The IUPAC name of [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate (CID 87497191) is [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate.
What is the SMILES notation for [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The canonical SMILES for [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate is NCCC[C@@H](N)C(=O)OC(=O)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The InChIKey is DCLSOJDVBSHQFL-RXMQYKEDSA-N. The full InChI is InChI=1S/C10H14N4O5/c11-3-1-2-5(12)8(16)19-9(17)6-4-7(15)14-10(18)13-6/h4-5H,1-3,11-12H2,(H2,13,14,15,18)/t5-/m1/s1.
What are the key properties of [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate?
[(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate has a molecular weight of 270.25 g/mol, XLogP of -2.19, 5 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2,5-diaminopentanoyl] 2,4-dioxo-1H-pyrimidine-6-carboxylate is sourced from PubChem (CID 87497191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).