C12H14N4O5 — CID 87497779
nitric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87497779) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is nitric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | nitric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87497779 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | nitric acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.O=[N+]([O-])O |
| InChI | InChI=1S/C12H13N3O2.HNO3/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;2-1(3)4/h7H,1-6H2;(H,2,3,4) |
| InChIKey | IXNYHXITKPIFKZ-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|