About (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate
(2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate (PubChem CID 87498175) has the molecular formula C24H28N4O4
and a molecular weight of 436.51 g/mol. Its IUPAC name is (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate |
| PubChem CID | 87498175 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate |
| SMILES | NCC(OC(=O)N(OC1CCC(O)CC1)c1ccc(-c2cn[nH]c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H28N4O4/c25-14-23(18-4-2-1-3-5-18)31-24(30)28(32-22-12-10-21(29)11-13-22)20-8-6-17(7-9-20)19-15-26-27-16-19/h1-9,15-16,21-23,29H,10-14,25H2,(H,26,27) |
| InChIKey | XSFNUIBOGAVOPG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate?
The IUPAC name of (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate (CID 87498175) is (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate.
What is the SMILES notation for (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate?
The canonical SMILES for (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate is NCC(OC(=O)N(OC1CCC(O)CC1)c1ccc(-c2cn[nH]c2)cc1)c1ccccc1.
What is the InChIKey of (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate?
The InChIKey is XSFNUIBOGAVOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4O4/c25-14-23(18-4-2-1-3-5-18)31-24(30)28(32-22-12-10-21(29)11-13-22)20-8-6-17(7-9-20)19-15-26-27-16-19/h1-9,15-16,21-23,29H,10-14,25H2,(H,26,27).
What are the key properties of (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate?
(2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate has a molecular weight of 436.51 g/mol, XLogP of 3.95, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1-phenylethyl) N-(4-hydroxycyclohexyl)oxy-N-[4-(1H-pyrazol-4-yl)phenyl]carbamate is sourced from PubChem (CID 87498175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).