C16H33NO3 — CID 87498301
N-(1,3-dihydroxypropan-2-yl)tridecanamide (PubChem CID 87498301) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)tridecanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)tridecanamide |
|---|---|
| PubChem CID | 87498301 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)tridecanamide |
| SMILES | CCCCCCCCCCCCC(=O)NC(CO)CO |
| InChI | InChI=1S/C16H33NO3/c1-2-3-4-5-6-7-8-9-10-11-12-16(20)17-15(13-18)14-19/h15,18-19H,2-14H2,1H3,(H,17,20) |
| InChIKey | JBXQURGIATWRID-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|