C37H18F6N4 — CID 87498317
5,10,15-tris(2,6-difluorophenyl)-21H-corrin (PubChem CID 87498317) has the molecular formula C37H18F6N4 and a molecular weight of 632.57 g/mol. Its IUPAC name is 5,10,15-tris(2,6-difluorophenyl)-21H-corrin.
| Compound Name | 5,10,15-tris(2,6-difluorophenyl)-21H-corrin |
|---|---|
| PubChem CID | 87498317 |
| Molecular Formula | C37H18F6N4 |
| Molecular Weight | 632.57 g/mol |
| Exact Mass | 632.14 |
| IUPAC Name | 5,10,15-tris(2,6-difluorophenyl)-21H-corrin |
| SMILES | Fc1cccc(F)c1/C1=C2\C=CC(=N2)/C(c2c(F)cccc2F)=C2/C=CC(=N2)/C(c2c(F)cccc2F)=c2/cc/c([nH]2)=C2\C=CC1=N2 |
| InChI | InChI=1S/C37H18F6N4/c38-18-4-1-5-19(39)32(18)35-26-12-10-24(44-26)25-11-13-27(45-25)36(33-20(40)6-2-7-21(33)41)29-15-17-31(47-29)37(30-16-14-28(35)46-30)34-22(42)8-3-9-23(34)43/h1-17,44H/b25-24-,35-26+,35-28+,36-27+,36-29+,37-30+,37-31+ |
| InChIKey | UWSYCTSQECQASR-QKUKPUCPSA-N |
| XLogP | 7.03 |
| TPSA | 52.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.57 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |