About 3-oxo-5,5-dipropoxypentanal
3-oxo-5,5-dipropoxypentanal (PubChem CID 87498434) has the molecular formula C11H20O4
and a molecular weight of 216.28 g/mol. Its IUPAC name is 3-oxo-5,5-dipropoxypentanal.
Molecular Properties
| Compound Name | 3-oxo-5,5-dipropoxypentanal |
| PubChem CID | 87498434 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 3-oxo-5,5-dipropoxypentanal |
| SMILES | CCCOC(CC(=O)CC=O)OCCC |
| InChI | InChI=1S/C11H20O4/c1-3-7-14-11(15-8-4-2)9-10(13)5-6-12/h6,11H,3-5,7-9H2,1-2H3 |
| InChIKey | RVPZUGSUMUJPLA-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-5,5-dipropoxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-5,5-dipropoxypentanal?
The IUPAC name of 3-oxo-5,5-dipropoxypentanal (CID 87498434) is 3-oxo-5,5-dipropoxypentanal.
What is the SMILES notation for 3-oxo-5,5-dipropoxypentanal?
The canonical SMILES for 3-oxo-5,5-dipropoxypentanal is CCCOC(CC(=O)CC=O)OCCC.
What is the InChIKey of 3-oxo-5,5-dipropoxypentanal?
The InChIKey is RVPZUGSUMUJPLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-3-7-14-11(15-8-4-2)9-10(13)5-6-12/h6,11H,3-5,7-9H2,1-2H3.
What are the key properties of 3-oxo-5,5-dipropoxypentanal?
3-oxo-5,5-dipropoxypentanal has a molecular weight of 216.28 g/mol, XLogP of 1.71, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-5,5-dipropoxypentanal is sourced from PubChem (CID 87498434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).