C13H21NO4 — CID 87498653
1-(2-methylprop-2-enoylamino)butan-2-yl 3-oxopentanoate (PubChem CID 87498653) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoylamino)butan-2-yl 3-oxopentanoate.
| Compound Name | 1-(2-methylprop-2-enoylamino)butan-2-yl 3-oxopentanoate |
|---|---|
| PubChem CID | 87498653 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 1-(2-methylprop-2-enoylamino)butan-2-yl 3-oxopentanoate |
| SMILES | C=C(C)C(=O)NCC(CC)OC(=O)CC(=O)CC |
| InChI | InChI=1S/C13H21NO4/c1-5-10(15)7-12(16)18-11(6-2)8-14-13(17)9(3)4/h11H,3,5-8H2,1-2,4H3,(H,14,17) |
| InChIKey | AMHLJCCFKBBSMG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|