C15H30S12 — CID 87499184
2-[2-[[4,6-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1,3,5-trithian-2-yl]sulfanyl]ethylsulfanyl]ethanethiol (PubChem CID 87499184) has the molecular formula C15H30S12 and a molecular weight of 595.21 g/mol. Its IUPAC name is 2-[2-[[4,6-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1,3,5-trithian-2-yl]sulfanyl]ethylsulfanyl]ethanethiol.
| Compound Name | 2-[2-[[4,6-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1,3,5-trithian-2-yl]sulfanyl]ethylsulfanyl]ethanethiol |
|---|---|
| PubChem CID | 87499184 |
| Molecular Formula | C15H30S12 |
| Molecular Weight | 595.21 g/mol |
| Exact Mass | 593.90 |
| IUPAC Name | 2-[2-[[4,6-bis[2-(2-sulfanylethylsulfanyl)ethylsulfanyl]-1,3,5-trithian-2-yl]sulfanyl]ethylsulfanyl]ethanethiol |
| SMILES | SCCSCCSC1SC(SCCSCCS)SC(SCCSCCS)S1 |
| InChI | InChI=1S/C15H30S12/c16-1-4-19-7-10-22-13-25-14(23-11-8-20-5-2-17)27-15(26-13)24-12-9-21-6-3-18/h13-18H,1-12H2 |
| InChIKey | DMBYUPZHEHFOKD-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.21 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|