About tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate
tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate (PubChem CID 87499311) has the molecular formula C15H12N3O10P
and a molecular weight of 425.25 g/mol. Its IUPAC name is tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate.
Molecular Properties
| Compound Name | tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate |
| PubChem CID | 87499311 |
| Molecular Formula | C15H12N3O10P |
| Molecular Weight | 425.25 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate |
| SMILES | O=Cc1cc(COP(=O)(OCc2cc(C=O)no2)OCc2cc(C=O)no2)on1 |
| InChI | InChI=1S/C15H12N3O10P/c19-4-10-1-13(26-16-10)7-23-29(22,24-8-14-2-11(5-20)17-27-14)25-9-15-3-12(6-21)18-28-15/h1-6H,7-9H2 |
| InChIKey | KTBLLOIJDKATDW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 174.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate?
The IUPAC name of tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate (CID 87499311) is tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate.
What is the SMILES notation for tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate?
The canonical SMILES for tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate is O=Cc1cc(COP(=O)(OCc2cc(C=O)no2)OCc2cc(C=O)no2)on1.
What is the InChIKey of tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate?
The InChIKey is KTBLLOIJDKATDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N3O10P/c19-4-10-1-13(26-16-10)7-23-29(22,24-8-14-2-11(5-20)17-27-14)25-9-15-3-12(6-21)18-28-15/h1-6H,7-9H2.
What are the key properties of tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate?
tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate has a molecular weight of 425.25 g/mol, XLogP of 2.15, 12 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for tris[(3-formyl-1,2-oxazol-5-yl)methyl] phosphate is sourced from PubChem (CID 87499311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).