C27H25F6N3O4 — CID 87499485
N-[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]methyl]-1-phenylmethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87499485) has the molecular formula C27H25F6N3O4 and a molecular weight of 569.50 g/mol. Its IUPAC name is N-[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]methyl]-1-phenylmethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]methyl]-1-phenylmethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87499485 |
| Molecular Formula | C27H25F6N3O4 |
| Molecular Weight | 569.50 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | N-[[(4R,5S)-4,5-diphenyl-4,5-dihydro-1H-imidazol-2-yl]methyl]-1-phenylmethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.c1ccc(CNCC2=N[C@H](c3ccccc3)[C@H](c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C23H23N3.2C2HF3O2/c1-4-10-18(11-5-1)16-24-17-21-25-22(19-12-6-2-7-13-19)23(26-21)20-14-8-3-9-15-20;2*3-2(4,5)1(6)7/h1-15,22-24H,16-17H2,(H,25,26);2*(H,6,7)/t22-,23+;; |
| InChIKey | KWSNDGJRXMCCLX-AJFFIPFFSA-N |
| XLogP | 5.53 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |