C21H19N3O6S — CID 87499500
ethyl 8-[methoxy(phenyl)sulfamoyl]-4-oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylate (PubChem CID 87499500) has the molecular formula C21H19N3O6S and a molecular weight of 441.47 g/mol. Its IUPAC name is ethyl 8-[methoxy(phenyl)sulfamoyl]-4-oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylate.
| Compound Name | ethyl 8-[methoxy(phenyl)sulfamoyl]-4-oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 87499500 |
| Molecular Formula | C21H19N3O6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | ethyl 8-[methoxy(phenyl)sulfamoyl]-4-oxo-3,5-dihydropyrrolo[2,3-c]quinoline-1-carboxylate |
| SMILES | CCOC(=O)c1c[nH]c2c(=O)[nH]c3ccc(S(=O)(=O)N(OC)c4ccccc4)cc3c12 |
| InChI | InChI=1S/C21H19N3O6S/c1-3-30-21(26)16-12-22-19-18(16)15-11-14(9-10-17(15)23-20(19)25)31(27,28)24(29-2)13-7-5-4-6-8-13/h4-12,22H,3H2,1-2H3,(H,23,25) |
| InChIKey | PPBSWHSSGVNUIC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 121.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|