About 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid
2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid (PubChem CID 87499553) has the molecular formula C19H16N2O5S2
and a molecular weight of 416.48 g/mol. Its IUPAC name is 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid |
| PubChem CID | 87499553 |
| Molecular Formula | C19H16N2O5S2 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.05 |
| IUPAC Name | 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid |
| SMILES | O=C(O)C(=O)CCc1cnc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C19H16N2O5S2/c22-17(18(23)24)11-8-15-12-20-19(27-15)21-28(25,26)16-9-6-14(7-10-16)13-4-2-1-3-5-13/h1-7,9-10,12H,8,11H2,(H,20,21)(H,23,24) |
| InChIKey | UZIBSPVUMDEHGW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 113.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
The IUPAC name of 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid (CID 87499553) is 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid.
What is the SMILES notation for 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
The canonical SMILES for 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid is O=C(O)C(=O)CCc1cnc(NS(=O)(=O)c2ccc(-c3ccccc3)cc2)s1.
What is the InChIKey of 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
The InChIKey is UZIBSPVUMDEHGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O5S2/c22-17(18(23)24)11-8-15-12-20-19(27-15)21-28(25,26)16-9-6-14(7-10-16)13-4-2-1-3-5-13/h1-7,9-10,12H,8,11H2,(H,20,21)(H,23,24).
What are the key properties of 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid has a molecular weight of 416.48 g/mol, XLogP of 3.20, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-4-[2-[(4-phenylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid is sourced from PubChem (CID 87499553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).