About 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid
2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid (PubChem CID 87499565) has the molecular formula C14H15FN2O4S2
and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid.
Molecular Properties
| Compound Name | 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid |
| PubChem CID | 87499565 |
| Molecular Formula | C14H15FN2O4S2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid |
| SMILES | CCC(C(=O)O)c1cnc(NS(=O)(=O)c2cc(F)ccc2C)s1 |
| InChI | InChI=1S/C14H15FN2O4S2/c1-3-10(13(18)19)11-7-16-14(22-11)17-23(20,21)12-6-9(15)5-4-8(12)2/h4-7,10H,3H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | SDNQABGJIITXCU-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
The IUPAC name of 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid (CID 87499565) is 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid.
What is the SMILES notation for 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
The canonical SMILES for 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid is CCC(C(=O)O)c1cnc(NS(=O)(=O)c2cc(F)ccc2C)s1.
What is the InChIKey of 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
The InChIKey is SDNQABGJIITXCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15FN2O4S2/c1-3-10(13(18)19)11-7-16-14(22-11)17-23(20,21)12-6-9(15)5-4-8(12)2/h4-7,10H,3H2,1-2H3,(H,16,17)(H,18,19).
What are the key properties of 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid?
2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid has a molecular weight of 358.42 g/mol, XLogP of 2.97, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(5-fluoro-2-methylphenyl)sulfonylamino]-1,3-thiazol-5-yl]butanoic acid is sourced from PubChem (CID 87499565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).