About 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide
3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide (PubChem CID 87499848) has the molecular formula C12H25N3O
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide.
Molecular Properties
| Compound Name | 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide |
| PubChem CID | 87499848 |
| Molecular Formula | C12H25N3O |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.20 |
| IUPAC Name | 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide |
| SMILES | C=CCN(C(C)C)N(C(=O)CCN)C(C)C |
| InChI | InChI=1S/C12H25N3O/c1-6-9-14(10(2)3)15(11(4)5)12(16)7-8-13/h6,10-11H,1,7-9,13H2,2-5H3 |
| InChIKey | JAEMRCBCNQWSFV-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide?
The IUPAC name of 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide (CID 87499848) is 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide.
What is the SMILES notation for 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide?
The canonical SMILES for 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide is C=CCN(C(C)C)N(C(=O)CCN)C(C)C.
What is the InChIKey of 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide?
The InChIKey is JAEMRCBCNQWSFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O/c1-6-9-14(10(2)3)15(11(4)5)12(16)7-8-13/h6,10-11H,1,7-9,13H2,2-5H3.
What are the key properties of 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide?
3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide has a molecular weight of 227.35 g/mol, XLogP of 1.38, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N'-di(propan-2-yl)-N'-prop-2-enylpropanehydrazide is sourced from PubChem (CID 87499848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).