About 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide
3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide (PubChem CID 87499869) has the molecular formula C10H21N3O
and a molecular weight of 199.30 g/mol. Its IUPAC name is 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide.
Molecular Properties
| Compound Name | 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide |
| PubChem CID | 87499869 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide |
| SMILES | C=CCN(CC)N(CC)C(=O)CCN |
| InChI | InChI=1S/C10H21N3O/c1-4-9-12(5-2)13(6-3)10(14)7-8-11/h4H,1,5-9,11H2,2-3H3 |
| InChIKey | CHVCUWJIRMNUIT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide?
The IUPAC name of 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide (CID 87499869) is 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide.
What is the SMILES notation for 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide?
The canonical SMILES for 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide is C=CCN(CC)N(CC)C(=O)CCN.
What is the InChIKey of 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide?
The InChIKey is CHVCUWJIRMNUIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N3O/c1-4-9-12(5-2)13(6-3)10(14)7-8-11/h4H,1,5-9,11H2,2-3H3.
What are the key properties of 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide?
3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide has a molecular weight of 199.30 g/mol, XLogP of 0.61, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N,N'-diethyl-N'-prop-2-enylpropanehydrazide is sourced from PubChem (CID 87499869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).