About N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide
N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide (PubChem CID 87499923) has the molecular formula C15H29N3O
and a molecular weight of 267.42 g/mol. Its IUPAC name is N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide.
Molecular Properties
| Compound Name | N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide |
| PubChem CID | 87499923 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide |
| SMILES | C=CCN(CC=C)N(C(=O)CCNCCC)C(C)C |
| InChI | InChI=1S/C15H29N3O/c1-6-10-16-11-9-15(19)18(14(4)5)17(12-7-2)13-8-3/h7-8,14,16H,2-3,6,9-13H2,1,4-5H3 |
| InChIKey | KBNBRNREJQXCEH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide?
The IUPAC name of N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide (CID 87499923) is N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide.
What is the SMILES notation for N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide?
The canonical SMILES for N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide is C=CCN(CC=C)N(C(=O)CCNCCC)C(C)C.
What is the InChIKey of N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide?
The InChIKey is KBNBRNREJQXCEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O/c1-6-10-16-11-9-15(19)18(14(4)5)17(12-7-2)13-8-3/h7-8,14,16H,2-3,6,9-13H2,1,4-5H3.
What are the key properties of N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide?
N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide has a molecular weight of 267.42 g/mol, XLogP of 2.20, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-N',N'-bis(prop-2-enyl)-3-(propylamino)propanehydrazide is sourced from PubChem (CID 87499923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).