About 2,3-dihydroxybutanedioic acid
2,3-dihydroxybutanedioic acid (PubChem CID 875) has the molecular formula C4H6O6
and a molecular weight of 150.09 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid.
Molecular Properties
| Compound Name | 2,3-dihydroxybutanedioic acid |
| PubChem CID | 875 |
| Molecular Formula | C4H6O6 |
| Molecular Weight | 150.09 g/mol |
| Exact Mass | 150.02 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | FEWJPZIEWOKRBE-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.09 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,3-dihydroxybutanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxybutanedioic acid?
The IUPAC name of 2,3-dihydroxybutanedioic acid (CID 875) is 2,3-dihydroxybutanedioic acid.
What is the SMILES notation for 2,3-dihydroxybutanedioic acid?
The canonical SMILES for 2,3-dihydroxybutanedioic acid is O=C(O)C(O)C(O)C(=O)O.
What is the InChIKey of 2,3-dihydroxybutanedioic acid?
The InChIKey is FEWJPZIEWOKRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10).
What are the key properties of 2,3-dihydroxybutanedioic acid?
2,3-dihydroxybutanedioic acid has a molecular weight of 150.09 g/mol, XLogP of -2.12, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxybutanedioic acid is sourced from PubChem (CID 875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).