About diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate
diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate (PubChem CID 87500443) has the molecular formula C27H54O8Si2
and a molecular weight of 562.89 g/mol. Its IUPAC name is diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate.
Molecular Properties
| Compound Name | diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate |
| PubChem CID | 87500443 |
| Molecular Formula | C27H54O8Si2 |
| Molecular Weight | 562.89 g/mol |
| Exact Mass | 562.34 |
| IUPAC Name | diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate |
| SMILES | CCOC(=O)C(C(C(=O)OCC)[Si](C)(C)C)[Si](C)(C)C.CCOC(=O)C(C)C(C(=O)OCC)C(C)CC |
| InChI | InChI=1S/C14H30O4Si2.C13H24O4/c1-9-17-13(15)11(19(3,4)5)12(20(6,7)8)14(16)18-10-2;1-6-9(4)11(13(15)17-8-3)10(5)12(14)16-7-2/h11-12H,9-10H2,1-8H3;9-11H,6-8H2,1-5H3 |
| InChIKey | KIYDYFIBYPNAQQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 562.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate?
The IUPAC name of diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate (CID 87500443) is diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate.
What is the SMILES notation for diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate?
The canonical SMILES for diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate is CCOC(=O)C(C(C(=O)OCC)[Si](C)(C)C)[Si](C)(C)C.CCOC(=O)C(C)C(C(=O)OCC)C(C)CC.
What is the InChIKey of diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate?
The InChIKey is KIYDYFIBYPNAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30O4Si2.C13H24O4/c1-9-17-13(15)11(19(3,4)5)12(20(6,7)8)14(16)18-10-2;1-6-9(4)11(13(15)17-8-3)10(5)12(14)16-7-2/h11-12H,9-10H2,1-8H3;9-11H,6-8H2,1-5H3.
What are the key properties of diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate?
diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate has a molecular weight of 562.89 g/mol, XLogP of 5.94, 14 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,3-bis(trimethylsilyl)butanedioate;diethyl 2-butan-2-yl-3-methylbutanedioate is sourced from PubChem (CID 87500443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).