About 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide
4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide (PubChem CID 87500697) has the molecular formula C15H11N3O4
and a molecular weight of 297.27 g/mol. Its IUPAC name is 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide |
| PubChem CID | 87500697 |
| Molecular Formula | C15H11N3O4 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(Cn2c(=O)oc(=O)c3ccccc32)ccn1 |
| InChI | InChI=1S/C15H11N3O4/c16-13(19)11-7-9(5-6-17-11)8-18-12-4-2-1-3-10(12)14(20)22-15(18)21/h1-7H,8H2,(H2,16,19) |
| InChIKey | SFBLTFZULKGUMQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide?
The IUPAC name of 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide (CID 87500697) is 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide.
What is the SMILES notation for 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide?
The canonical SMILES for 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide is NC(=O)c1cc(Cn2c(=O)oc(=O)c3ccccc32)ccn1.
What is the InChIKey of 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide?
The InChIKey is SFBLTFZULKGUMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O4/c16-13(19)11-7-9(5-6-17-11)8-18-12-4-2-1-3-10(12)14(20)22-15(18)21/h1-7H,8H2,(H2,16,19).
What are the key properties of 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide?
4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide has a molecular weight of 297.27 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,4-dioxo-3,1-benzoxazin-1-yl)methyl]pyridine-2-carboxamide is sourced from PubChem (CID 87500697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).