About 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid
5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid (PubChem CID 87501105) has the molecular formula C9H10N2O11
and a molecular weight of 322.18 g/mol. Its IUPAC name is 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid |
| PubChem CID | 87501105 |
| Molecular Formula | C9H10N2O11 |
| Molecular Weight | 322.18 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid |
| SMILES | O=C(O)c1oc(=O)oc1CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N2O11/c12-8(13)7-6(20-9(14)21-7)3-1-2-5(22-11(17)18)4-19-10(15)16/h5H,1-4H2,(H,12,13)/t5-/m1/s1 |
| InChIKey | YHWRIINDWYNLJB-RXMQYKEDSA-N |
| XLogP | 0.04 |
| TPSA | 185.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.18 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid?
The IUPAC name of 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid (CID 87501105) is 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid.
What is the SMILES notation for 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid?
The canonical SMILES for 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid is O=C(O)c1oc(=O)oc1CCC[C@H](CO[N+](=O)[O-])O[N+](=O)[O-].
What is the InChIKey of 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid?
The InChIKey is YHWRIINDWYNLJB-RXMQYKEDSA-N. The full InChI is InChI=1S/C9H10N2O11/c12-8(13)7-6(20-9(14)21-7)3-1-2-5(22-11(17)18)4-19-10(15)16/h5H,1-4H2,(H,12,13)/t5-/m1/s1.
What are the key properties of 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid?
5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid has a molecular weight of 322.18 g/mol, XLogP of 0.04, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4R)-4,5-dinitrooxypentyl]-2-oxo-1,3-dioxole-4-carboxylic acid is sourced from PubChem (CID 87501105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).