About 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine
1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine (PubChem CID 87501132) has the molecular formula C6H14N4O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine.
Molecular Properties
| Compound Name | 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine |
| PubChem CID | 87501132 |
| Molecular Formula | C6H14N4O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine |
| SMILES | C=C(N)C(N)OC(N)C(=C)N |
| InChI | InChI=1S/C6H14N4O/c1-3(7)5(9)11-6(10)4(2)8/h5-6H,1-2,7-10H2 |
| InChIKey | CIQDRAQMNJPXII-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine?
The IUPAC name of 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine (CID 87501132) is 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine.
What is the SMILES notation for 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine?
The canonical SMILES for 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine is C=C(N)C(N)OC(N)C(=C)N.
What is the InChIKey of 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine?
The InChIKey is CIQDRAQMNJPXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N4O/c1-3(7)5(9)11-6(10)4(2)8/h5-6H,1-2,7-10H2.
What are the key properties of 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine?
1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine has a molecular weight of 158.20 g/mol, XLogP of -1.48, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,2-diaminoprop-2-enoxy)prop-2-ene-1,2-diamine is sourced from PubChem (CID 87501132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).