About (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine
(2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine (PubChem CID 87501530) has the molecular formula C22H27N2+
and a molecular weight of 319.47 g/mol. Its IUPAC name is (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine.
Molecular Properties
| Compound Name | (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine |
| PubChem CID | 87501530 |
| Molecular Formula | C22H27N2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine |
| SMILES | C(N1CC(c2ccccc2)CC[C@@H]1c1ccccc1)=[N+]1CCCC1 |
| InChI | InChI=1S/C22H27N2/c1-3-9-19(10-4-1)21-13-14-22(20-11-5-2-6-12-20)24(17-21)18-23-15-7-8-16-23/h1-6,9-12,18,21-22H,7-8,13-17H2/q+1/t21?,22-/m1/s1 |
| InChIKey | KKAZPHDIQRKQBM-FOIFJWKZSA-N |
| XLogP | 4.44 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine?
The IUPAC name of (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine (CID 87501530) is (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine.
What is the SMILES notation for (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine?
The canonical SMILES for (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine is C(N1CC(c2ccccc2)CC[C@@H]1c1ccccc1)=[N+]1CCCC1.
What is the InChIKey of (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine?
The InChIKey is KKAZPHDIQRKQBM-FOIFJWKZSA-N. The full InChI is InChI=1S/C22H27N2/c1-3-9-19(10-4-1)21-13-14-22(20-11-5-2-6-12-20)24(17-21)18-23-15-7-8-16-23/h1-6,9-12,18,21-22H,7-8,13-17H2/q+1/t21?,22-/m1/s1.
What are the key properties of (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine?
(2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine has a molecular weight of 319.47 g/mol, XLogP of 4.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,5-diphenyl-1-(pyrrolidin-1-ium-1-ylidenemethyl)piperidine is sourced from PubChem (CID 87501530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).