About 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene
2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene (PubChem CID 87501958) has the molecular formula C12H6Cl6F3N3
and a molecular weight of 461.91 g/mol. Its IUPAC name is 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene.
Molecular Properties
| Compound Name | 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene |
| PubChem CID | 87501958 |
| Molecular Formula | C12H6Cl6F3N3 |
| Molecular Weight | 461.91 g/mol |
| Exact Mass | 458.86 |
| IUPAC Name | 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene |
| SMILES | ClC(Cl)(Cl)c1ncncn1.FC(F)(F)c1cccc(C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C8H4Cl3F3.C4H2Cl3N3/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;5-4(6,7)3-9-1-8-2-10-3/h1-4H;1-2H |
| InChIKey | HIPBBVQAFHOGJT-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.91 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene?
The IUPAC name of 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene (CID 87501958) is 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene.
What is the SMILES notation for 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene?
The canonical SMILES for 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene is ClC(Cl)(Cl)c1ncncn1.FC(F)(F)c1cccc(C(Cl)(Cl)Cl)c1.
What is the InChIKey of 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene?
The InChIKey is HIPBBVQAFHOGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl3F3.C4H2Cl3N3/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14;5-4(6,7)3-9-1-8-2-10-3/h1-4H;1-2H.
What are the key properties of 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene?
2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene has a molecular weight of 461.91 g/mol, XLogP of 6.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trichloromethyl)-1,3,5-triazine;1-(trichloromethyl)-3-(trifluoromethyl)benzene is sourced from PubChem (CID 87501958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).