C16H19N5O8 — CID 87502019
N-(furan-2-ylmethyl)-7H-purin-6-amine;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid (PubChem CID 87502019) has the molecular formula C16H19N5O8 and a molecular weight of 409.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-7H-purin-6-amine;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid.
| Compound Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87502019 |
| Molecular Formula | C16H19N5O8 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-(furan-2-ylmethyl)-7H-purin-6-amine;(2S,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexanoic acid |
| SMILES | O=C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)C(=O)O.c1coc(CNc2ncnc3nc[nH]c23)c1 |
| InChI | InChI=1S/C10H9N5O.C6H10O7/c1-2-7(16-3-1)4-11-9-8-10(13-5-12-8)15-6-14-9;7-1-2(8)3(9)4(10)5(11)6(12)13/h1-3,5-6H,4H2,(H2,11,12,13,14,15);1-5,8-11H,(H,12,13)/t;2-,3+,4-,5-/m.0/s1 |
| InChIKey | VJCUDFYPFMEIQR-LRDBBFHQSA-N |
| XLogP | -1.73 |
| TPSA | 214.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|