C12H17N3 — CID 87504345
1-N,1-N,8-N-trimethyl-6H-quinolizine-1,8-diamine (PubChem CID 87504345) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-N,1-N,8-N-trimethyl-6H-quinolizine-1,8-diamine.
| Compound Name | 1-N,1-N,8-N-trimethyl-6H-quinolizine-1,8-diamine |
|---|---|
| PubChem CID | 87504345 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-N,1-N,8-N-trimethyl-6H-quinolizine-1,8-diamine |
| SMILES | CNC1=CCN2C=CC=C(N(C)C)C2=C1 |
| InChI | InChI=1S/C12H17N3/c1-13-10-6-8-15-7-4-5-11(14(2)3)12(15)9-10/h4-7,9,13H,8H2,1-3H3 |
| InChIKey | ARSDKIJPPWMPLZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |