C22H23NO2 — CID 87504750
(2R,4aR,10aS)-4a-benzyl-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthrene-2-carbonitrile (PubChem CID 87504750) has the molecular formula C22H23NO2 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R,4aR,10aS)-4a-benzyl-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthrene-2-carbonitrile.
| Compound Name | (2R,4aR,10aS)-4a-benzyl-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 87504750 |
| Molecular Formula | C22H23NO2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | (2R,4aR,10aS)-4a-benzyl-2,7-dihydroxy-1,3,4,9,10,10a-hexahydrophenanthrene-2-carbonitrile |
| SMILES | N#C[C@@]1(O)CC[C@]2(Cc3ccccc3)c3ccc(O)cc3CC[C@H]2C1 |
| InChI | InChI=1S/C22H23NO2/c23-15-21(25)10-11-22(13-16-4-2-1-3-5-16)18(14-21)7-6-17-12-19(24)8-9-20(17)22/h1-5,8-9,12,18,24-25H,6-7,10-11,13-14H2/t18-,21+,22+/m0/s1 |
| InChIKey | DJLIPXQYQQRTHS-VLCRHTCISA-N |
| XLogP | 3.87 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|