C29H31F6N7O7 — CID 87505011
N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87505011) has the molecular formula C29H31F6N7O7 and a molecular weight of 703.60 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87505011 |
| Molecular Formula | C29H31F6N7O7 |
| Molecular Weight | 703.60 g/mol |
| Exact Mass | 703.22 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc2nc(C(=O)NCc3ccc4c(c3)OCO4)nc(NC3CCCCC3N=C(N)N)c2c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H29N7O3.2C2HF3O2/c1-14-6-8-17-16(10-14)22(30-18-4-2-3-5-19(18)31-25(26)27)32-23(29-17)24(33)28-12-15-7-9-20-21(11-15)35-13-34-20;2*3-2(4,5)1(6)7/h6-11,18-19H,2-5,12-13H2,1H3,(H,28,33)(H4,26,27,31)(H,29,30,32);2*(H,6,7) |
| InChIKey | JYOJREWQIUJSJK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 224.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.60 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|