C26H29F6N7O5S — CID 87505086
4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(thiophen-2-ylmethyl)quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87505086) has the molecular formula C26H29F6N7O5S and a molecular weight of 665.62 g/mol. Its IUPAC name is 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(thiophen-2-ylmethyl)quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(thiophen-2-ylmethyl)quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87505086 |
| Molecular Formula | C26H29F6N7O5S |
| Molecular Weight | 665.62 g/mol |
| Exact Mass | 665.19 |
| IUPAC Name | 4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methyl-N-(thiophen-2-ylmethyl)quinazoline-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc2nc(C(=O)NCc3cccs3)nc(NC3CCCCC3N=C(N)N)c2c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H27N7OS.2C2HF3O2/c1-13-8-9-16-15(11-13)19(27-17-6-2-3-7-18(17)28-22(23)24)29-20(26-16)21(30)25-12-14-5-4-10-31-14;2*3-2(4,5)1(6)7/h4-5,8-11,17-18H,2-3,6-7,12H2,1H3,(H,25,30)(H4,23,24,28)(H,26,27,29);2*(H,6,7) |
| InChIKey | PZFFEFVWCWMUDP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 205.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.62 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|