C26H30O4S — CID 87505088
[(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]methyl methanesulfonate (PubChem CID 87505088) has the molecular formula C26H30O4S and a molecular weight of 438.59 g/mol. Its IUPAC name is [(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]methyl methanesulfonate.
| Compound Name | [(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 87505088 |
| Molecular Formula | C26H30O4S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | [(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-prop-1-ynyl-5,6,8,8a,9,10-hexahydrophenanthren-2-yl]methyl methanesulfonate |
| SMILES | CC#C[C@@]1(O)CC[C@@]2(Cc3ccccc3)c3ccc(COS(C)(=O)=O)cc3CC[C@@H]2C1 |
| InChI | InChI=1S/C26H30O4S/c1-3-13-25(27)14-15-26(17-20-7-5-4-6-8-20)23(18-25)11-10-22-16-21(9-12-24(22)26)19-30-31(2,28)29/h4-9,12,16,23,27H,10-11,14-15,17-19H2,1-2H3/t23-,25-,26+/m1/s1 |
| InChIKey | WXHHITOUWJJFDQ-ARMFNRFLSA-N |
| XLogP | 4.14 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|