C20H26CoO2 — CID 87505213
cobalt(2+);bis((2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methanone) (PubChem CID 87505213) has the molecular formula C20H26CoO2 and a molecular weight of 357.36 g/mol. Its IUPAC name is cobalt(2+);bis((2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methanone).
| Compound Name | cobalt(2+);bis((2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methanone) |
|---|---|
| PubChem CID | 87505213 |
| Molecular Formula | C20H26CoO2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | cobalt(2+);bis((2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)methanone) |
| SMILES | CC1=C(C)C(C)C([C-]=O)=C1C.CC1=C(C)C(C)C([C-]=O)=C1C.[Co+2] |
| InChI | InChI=1S/2C10H13O.Co/c2*1-6-7(2)9(4)10(5-11)8(6)3;/h2*8H,1-4H3;/q2*-1;+2 |
| InChIKey | QKKDFUYIARKROV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|