C29H29ClF6N8O5 — CID 87505323
5-chloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1H-indole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87505323) has the molecular formula C29H29ClF6N8O5 and a molecular weight of 719.04 g/mol. Its IUPAC name is 5-chloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1H-indole-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-chloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1H-indole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87505323 |
| Molecular Formula | C29H29ClF6N8O5 |
| Molecular Weight | 719.04 g/mol |
| Exact Mass | 718.19 |
| IUPAC Name | 5-chloro-N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]-1H-indole-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc2nc(NC(=O)c3cc4cc(Cl)ccc4[nH]3)nc(NC3CCCCC3N=C(N)N)c2c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H27ClN8O.2C2HF3O2/c1-13-6-8-18-16(10-13)22(30-19-4-2-3-5-20(19)31-24(27)28)33-25(32-18)34-23(35)21-12-14-11-15(26)7-9-17(14)29-21;2*3-2(4,5)1(6)7/h6-12,19-20,29H,2-5H2,1H3,(H4,27,28,31)(H2,30,32,33,34,35);2*(H,6,7) |
| InChIKey | ZOSVMLRYKIEBQE-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 221.70 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.04 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|