C18H20F3N3O5S — CID 87505522
(2,2,2-trifluoroacetyl) 6-[2-(2-aminoethoxy)ethylsulfanyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate (PubChem CID 87505522) has the molecular formula C18H20F3N3O5S and a molecular weight of 447.44 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 6-[2-(2-aminoethoxy)ethylsulfanyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) 6-[2-(2-aminoethoxy)ethylsulfanyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 87505522 |
| Molecular Formula | C18H20F3N3O5S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 6-[2-(2-aminoethoxy)ethylsulfanyl]-1-(dimethylamino)-4-oxoquinoline-3-carboxylate |
| SMILES | CN(C)n1cc(C(=O)OC(=O)C(F)(F)F)c(=O)c2cc(SCCOCCN)ccc21 |
| InChI | InChI=1S/C18H20F3N3O5S/c1-23(2)24-10-13(16(26)29-17(27)18(19,20)21)15(25)12-9-11(3-4-14(12)24)30-8-7-28-6-5-22/h3-4,9-10H,5-8,22H2,1-2H3 |
| InChIKey | MKYZTUYQPSCMIW-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|