C23H31F3N3O5+ — CID 87506124
[1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-(2-methoxyethyl)piperazin-1-ium-1-yl] 2,2,2-trifluoroacetate (PubChem CID 87506124) has the molecular formula C23H31F3N3O5+ and a molecular weight of 486.51 g/mol. Its IUPAC name is [1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-(2-methoxyethyl)piperazin-1-ium-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-(2-methoxyethyl)piperazin-1-ium-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87506124 |
| Molecular Formula | C23H31F3N3O5+ |
| Molecular Weight | 486.51 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [1-[4-(2,5-dioxo-3,4-dihydro-1-benzazepin-1-yl)butyl]-4-(2-methoxyethyl)piperazin-1-ium-1-yl] 2,2,2-trifluoroacetate |
| SMILES | COCCN1CC[N+](CCCCN2C(=O)CCC(=O)c3ccccc32)(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H31F3N3O5/c1-33-17-13-27-11-15-29(16-12-27,34-22(32)23(24,25)26)14-5-4-10-28-19-7-3-2-6-18(19)20(30)8-9-21(28)31/h2-3,6-7H,4-5,8-17H2,1H3/q+1 |
| InChIKey | KJFHJEKYMVZWAN-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|