About 1,3-dinitroisoquinoline
1,3-dinitroisoquinoline (PubChem CID 87506157) has the molecular formula C9H5N3O4
and a molecular weight of 219.16 g/mol. Its IUPAC name is 1,3-dinitroisoquinoline.
Molecular Properties
| Compound Name | 1,3-dinitroisoquinoline |
| PubChem CID | 87506157 |
| Molecular Formula | C9H5N3O4 |
| Molecular Weight | 219.16 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 1,3-dinitroisoquinoline |
| SMILES | O=[N+]([O-])c1cc2ccccc2c([N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H5N3O4/c13-11(14)8-5-6-3-1-2-4-7(6)9(10-8)12(15)16/h1-5H |
| InChIKey | PCKYORHAGTXIMY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dinitroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dinitroisoquinoline?
The IUPAC name of 1,3-dinitroisoquinoline (CID 87506157) is 1,3-dinitroisoquinoline.
What is the SMILES notation for 1,3-dinitroisoquinoline?
The canonical SMILES for 1,3-dinitroisoquinoline is O=[N+]([O-])c1cc2ccccc2c([N+](=O)[O-])n1.
What is the InChIKey of 1,3-dinitroisoquinoline?
The InChIKey is PCKYORHAGTXIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O4/c13-11(14)8-5-6-3-1-2-4-7(6)9(10-8)12(15)16/h1-5H.
What are the key properties of 1,3-dinitroisoquinoline?
1,3-dinitroisoquinoline has a molecular weight of 219.16 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dinitroisoquinoline is sourced from PubChem (CID 87506157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).