C25H29N7O — CID 87506255
N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide (PubChem CID 87506255) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide.
| Compound Name | N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
|---|---|
| PubChem CID | 87506255 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | N-[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazolin-2-yl]bicyclo[4.2.0]octa-1,3,5-triene-7-carboxamide |
| SMILES | Cc1ccc2nc(NC(=O)C3Cc4ccccc43)nc(NC3CCCCC3N=C(N)N)c2c1 |
| InChI | InChI=1S/C25H29N7O/c1-14-10-11-19-18(12-14)22(28-20-8-4-5-9-21(20)29-24(26)27)31-25(30-19)32-23(33)17-13-15-6-2-3-7-16(15)17/h2-3,6-7,10-12,17,20-21H,4-5,8-9,13H2,1H3,(H4,26,27,29)(H2,28,30,31,32,33) |
| InChIKey | HHRWRKYOPGDVEE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|