C24H19F3N2O5S — CID 87506934
[6-(2-hydroxyethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-2-yl] trifluoromethanesulfonate (PubChem CID 87506934) has the molecular formula C24H19F3N2O5S and a molecular weight of 504.49 g/mol. Its IUPAC name is [6-(2-hydroxyethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-(2-hydroxyethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87506934 |
| Molecular Formula | C24H19F3N2O5S |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | [6-(2-hydroxyethyl)-7-methyl-5-(2-oxa-8-azatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaen-10-yl)quinolin-2-yl] trifluoromethanesulfonate |
| SMILES | Cc1cc2nc(OS(=O)(=O)C(F)(F)F)ccc2c(-c2ccc3c4c(ccnc24)CCO3)c1CCO |
| InChI | InChI=1S/C24H19F3N2O5S/c1-13-12-18-16(3-5-20(29-18)34-35(31,32)24(25,26)27)22(15(13)7-10-30)17-2-4-19-21-14(8-11-33-19)6-9-28-23(17)21/h2-6,9,12,30H,7-8,10-11H2,1H3 |
| InChIKey | BTKMUFABFSWWIU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|