C29H35N3O4 — CID 87507127
[15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-octylcarbamic acid (PubChem CID 87507127) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is [15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-octylcarbamic acid.
| Compound Name | [15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-octylcarbamic acid |
|---|---|
| PubChem CID | 87507127 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | [15-[2-(dimethylamino)ethyl]-14,16-dioxo-15-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,10,12-heptaen-6-yl]-octylcarbamic acid |
| SMILES | CCCCCCCCN(C(=O)O)c1cccc2c3c4c(cccc4cc12)C(=O)N(CCN(C)C)C3=O |
| InChI | InChI=1S/C29H35N3O4/c1-4-5-6-7-8-9-16-31(29(35)36)24-15-11-13-21-23(24)19-20-12-10-14-22-25(20)26(21)28(34)32(27(22)33)18-17-30(2)3/h10-15,19H,4-9,16-18H2,1-3H3,(H,35,36) |
| InChIKey | YSCFQKGWZYLYHV-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|