C14H20N4O6 — CID 87507292
(hydroxymethylamino)methanetriol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 87507292) has the molecular formula C14H20N4O6 and a molecular weight of 340.34 g/mol. Its IUPAC name is (hydroxymethylamino)methanetriol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | (hydroxymethylamino)methanetriol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 87507292 |
| Molecular Formula | C14H20N4O6 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (hydroxymethylamino)methanetriol;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.OCNC(O)(O)O |
| InChI | InChI=1S/C12H13N3O2.C2H7NO4/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;4-1-3-2(5,6)7/h7H,1-6H2;3-7H,1H2 |
| InChIKey | VCPNWCOSGJWWCF-UHFFFAOYSA-N |
| XLogP | -3.71 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|