About 1-fluoroprop-2-enyl trifluoromethanesulfonate
1-fluoroprop-2-enyl trifluoromethanesulfonate (PubChem CID 87507626) has the molecular formula C4H4F4O3S
and a molecular weight of 208.13 g/mol. Its IUPAC name is 1-fluoroprop-2-enyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 1-fluoroprop-2-enyl trifluoromethanesulfonate |
| PubChem CID | 87507626 |
| Molecular Formula | C4H4F4O3S |
| Molecular Weight | 208.13 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | 1-fluoroprop-2-enyl trifluoromethanesulfonate |
| SMILES | C=CC(F)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H4F4O3S/c1-2-3(5)11-12(9,10)4(6,7)8/h2-3H,1H2 |
| InChIKey | LKOIQXHKSVWMQD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.13 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoroprop-2-enyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoroprop-2-enyl trifluoromethanesulfonate?
The IUPAC name of 1-fluoroprop-2-enyl trifluoromethanesulfonate (CID 87507626) is 1-fluoroprop-2-enyl trifluoromethanesulfonate.
What is the SMILES notation for 1-fluoroprop-2-enyl trifluoromethanesulfonate?
The canonical SMILES for 1-fluoroprop-2-enyl trifluoromethanesulfonate is C=CC(F)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of 1-fluoroprop-2-enyl trifluoromethanesulfonate?
The InChIKey is LKOIQXHKSVWMQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4F4O3S/c1-2-3(5)11-12(9,10)4(6,7)8/h2-3H,1H2.
What are the key properties of 1-fluoroprop-2-enyl trifluoromethanesulfonate?
1-fluoroprop-2-enyl trifluoromethanesulfonate has a molecular weight of 208.13 g/mol, XLogP of 1.33, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoroprop-2-enyl trifluoromethanesulfonate is sourced from PubChem (CID 87507626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).